C14H22INOS — CID 79693520
5-iodo-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-carboxamide (PubChem CID 79693520) has the molecular formula C14H22INOS and a molecular weight of 379.31 g/mol. Its IUPAC name is 5-iodo-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693520 |
| Molecular Formula | C14H22INOS |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 5-iodo-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-carboxamide |
| SMILES | CCC(CC)N(CC(C)C)C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C14H22INOS/c1-5-12(6-2)16(8-10(3)4)14(17)11-7-13(15)18-9-11/h7,9-10,12H,5-6,8H2,1-4H3 |
| InChIKey | LYYDCAOLOFBHJB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|