C15H29NO2 — CID 79695027
2-(3,3-dipropylazetidin-1-yl)-2-methylpentanoic acid (PubChem CID 79695027) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-(3,3-dipropylazetidin-1-yl)-2-methylpentanoic acid.
| Compound Name | 2-(3,3-dipropylazetidin-1-yl)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 79695027 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-(3,3-dipropylazetidin-1-yl)-2-methylpentanoic acid |
| SMILES | CCCC1(CCC)CN(C(C)(CCC)C(=O)O)C1 |
| InChI | InChI=1S/C15H29NO2/c1-5-8-14(4,13(17)18)16-11-15(12-16,9-6-2)10-7-3/h5-12H2,1-4H3,(H,17,18) |
| InChIKey | UXVHZVYLHXCECG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |