C13H17NO3 — CID 79695506
2-[2-(3-ethylazetidin-1-yl)phenoxy]acetic acid (PubChem CID 79695506) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[2-(3-ethylazetidin-1-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-(3-ethylazetidin-1-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 79695506 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[2-(3-ethylazetidin-1-yl)phenoxy]acetic acid |
| SMILES | CCC1CN(c2ccccc2OCC(=O)O)C1 |
| InChI | InChI=1S/C13H17NO3/c1-2-10-7-14(8-10)11-5-3-4-6-12(11)17-9-13(15)16/h3-6,10H,2,7-9H2,1H3,(H,15,16) |
| InChIKey | HUJJENXSBAJGDR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |