2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid

C17H31NO2 — CID 79695676

IUPAC2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid
SMILESCCCC1(CCC)CN(C(C(=O)O)C2CCCCC2)C1
InChIInChI=1S/C17H31NO2/c1-3-10-17(11-4-2)12-18(13-17)15(16(19)20)14-8-6-5-7-9-14/h14-15H,3-13H2,1-2H3,(H,19,20)
InChIKeyNSFFPDMPQZSXOX-UHFFFAOYSA-N
MW281.44 g/mol
LogP3.92
Rot. Bonds7

About 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid

2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid (PubChem CID 79695676) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid.

Molecular Properties

Compound Name2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid
PubChem CID79695676
Molecular FormulaC17H31NO2
Molecular Weight281.44 g/mol
Exact Mass281.24
IUPAC Name2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid
SMILESCCCC1(CCC)CN(C(C(=O)O)C2CCCCC2)C1
InChIInChI=1S/C17H31NO2/c1-3-10-17(11-4-2)12-18(13-17)15(16(19)20)14-8-6-5-7-9-14/h14-15H,3-13H2,1-2H3,(H,19,20)
InChIKeyNSFFPDMPQZSXOX-UHFFFAOYSA-N
XLogP3.92
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.44
LogP ≤ 53.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid?
The IUPAC name of 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid (CID 79695676) is 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid.
What is the SMILES notation for 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid?
The canonical SMILES for 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid is CCCC1(CCC)CN(C(C(=O)O)C2CCCCC2)C1.
What is the InChIKey of 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid?
The InChIKey is NSFFPDMPQZSXOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO2/c1-3-10-17(11-4-2)12-18(13-17)15(16(19)20)14-8-6-5-7-9-14/h14-15H,3-13H2,1-2H3,(H,19,20).
What are the key properties of 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid?
2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid has a molecular weight of 281.44 g/mol, XLogP of 3.92, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-(3,3-dipropylazetidin-1-yl)acetic acid is sourced from PubChem (CID 79695676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).