C14H15NO3S — CID 79696380
[5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 79696380) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is [5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | [5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 79696380 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | [5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | O=C(c1csc(C#CCO)c1)N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C14H15NO3S/c16-5-1-2-13-6-10(9-19-13)14(17)15-7-11-3-4-12(8-15)18-11/h6,9,11-12,16H,3-5,7-8H2 |
| InChIKey | YKIJIWUVMHQLOW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|