C14H17NO2S — CID 79696793
(3,4-dimethylpyrrolidin-1-yl)-[5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]methanone (PubChem CID 79696793) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (3,4-dimethylpyrrolidin-1-yl)-[5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]methanone.
| Compound Name | (3,4-dimethylpyrrolidin-1-yl)-[5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 79696793 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (3,4-dimethylpyrrolidin-1-yl)-[5-(3-hydroxyprop-1-ynyl)thiophen-3-yl]methanone |
| SMILES | CC1CN(C(=O)c2csc(C#CCO)c2)CC1C |
| InChI | InChI=1S/C14H17NO2S/c1-10-7-15(8-11(10)2)14(17)12-6-13(18-9-12)4-3-5-16/h6,9-11,16H,5,7-8H2,1-2H3 |
| InChIKey | QQRMXZRZWOTTPD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|