C15H20FN3O3S — CID 7969798
N-[(2S)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide (PubChem CID 7969798) has the molecular formula C15H20FN3O3S and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[(2S)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7969798 |
| Molecular Formula | C15H20FN3O3S |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[(2S)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](C(=O)NNC(=O)CSc1ccccc1F)C(C)C |
| InChI | InChI=1S/C15H20FN3O3S/c1-9(2)14(17-10(3)20)15(22)19-18-13(21)8-23-12-7-5-4-6-11(12)16/h4-7,9,14H,8H2,1-3H3,(H,17,20)(H,18,21)(H,19,22)/t14-/m0/s1 |
| InChIKey | DMNHSAWPHGHPGN-AWEZNQCLSA-N |
| XLogP | 1.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|