C13H15BrFN3 — CID 79701330
N-[[1-[(3-bromo-5-fluorophenyl)methyl]imidazol-2-yl]methyl]ethanamine (PubChem CID 79701330) has the molecular formula C13H15BrFN3 and a molecular weight of 312.19 g/mol. Its IUPAC name is N-[[1-[(3-bromo-5-fluorophenyl)methyl]imidazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(3-bromo-5-fluorophenyl)methyl]imidazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 79701330 |
| Molecular Formula | C13H15BrFN3 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[[1-[(3-bromo-5-fluorophenyl)methyl]imidazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1nccn1Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H15BrFN3/c1-2-16-8-13-17-3-4-18(13)9-10-5-11(14)7-12(15)6-10/h3-7,16H,2,8-9H2,1H3 |
| InChIKey | MJFVJCXDUFFJJH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |