C11H9ClF2N2 — CID 105405211
2-(chloromethyl)-1-[(3,5-difluorophenyl)methyl]imidazole (PubChem CID 105405211) has the molecular formula C11H9ClF2N2 and a molecular weight of 242.66 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[(3,5-difluorophenyl)methyl]imidazole.
| Compound Name | 2-(chloromethyl)-1-[(3,5-difluorophenyl)methyl]imidazole |
|---|---|
| PubChem CID | 105405211 |
| Molecular Formula | C11H9ClF2N2 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-(chloromethyl)-1-[(3,5-difluorophenyl)methyl]imidazole |
| SMILES | Fc1cc(F)cc(Cn2ccnc2CCl)c1 |
| InChI | InChI=1S/C11H9ClF2N2/c12-6-11-15-1-2-16(11)7-8-3-9(13)5-10(14)4-8/h1-5H,6-7H2 |
| InChIKey | WHUAVUABJJULFO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|