C14H16FNO3S — CID 79704438
3-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 79704438) has the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 79704438 |
| Molecular Formula | C14H16FNO3S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | O=S1(=O)CCN(Cc2cc(F)cc(C#CCO)c2)CC1 |
| InChI | InChI=1S/C14H16FNO3S/c15-14-9-12(2-1-5-17)8-13(10-14)11-16-3-6-20(18,19)7-4-16/h8-10,17H,3-7,11H2 |
| InChIKey | GXSKFYIXXKTFPQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|