C15H19FN2S — CID 79706616
N-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl]-N-methylthiolan-3-amine (PubChem CID 79706616) has the molecular formula C15H19FN2S and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl]-N-methylthiolan-3-amine.
| Compound Name | N-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl]-N-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79706616 |
| Molecular Formula | C15H19FN2S |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methyl]-N-methylthiolan-3-amine |
| SMILES | CN(Cc1cc(F)cc(C#CCN)c1)C1CCSC1 |
| InChI | InChI=1S/C15H19FN2S/c1-18(15-4-6-19-11-15)10-13-7-12(3-2-5-17)8-14(16)9-13/h7-9,15H,4-6,10-11,17H2,1H3 |
| InChIKey | NLLPWFMUTRULSV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|