C12H17BFNO2S — CID 79710646
[3-fluoro-5-[[methyl(thiolan-3-yl)amino]methyl]phenyl]boronic acid (PubChem CID 79710646) has the molecular formula C12H17BFNO2S and a molecular weight of 269.15 g/mol. Its IUPAC name is [3-fluoro-5-[[methyl(thiolan-3-yl)amino]methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[[methyl(thiolan-3-yl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 79710646 |
| Molecular Formula | C12H17BFNO2S |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [3-fluoro-5-[[methyl(thiolan-3-yl)amino]methyl]phenyl]boronic acid |
| SMILES | CN(Cc1cc(F)cc(B(O)O)c1)C1CCSC1 |
| InChI | InChI=1S/C12H17BFNO2S/c1-15(12-2-3-18-8-12)7-9-4-10(13(16)17)6-11(14)5-9/h4-6,12,16-17H,2-3,7-8H2,1H3 |
| InChIKey | BIIMGEGSVIPUTI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|