C14H23BFNO2 — CID 79710580
[3-fluoro-5-[[methyl(4-methylpentan-2-yl)amino]methyl]phenyl]boronic acid (PubChem CID 79710580) has the molecular formula C14H23BFNO2 and a molecular weight of 267.15 g/mol. Its IUPAC name is [3-fluoro-5-[[methyl(4-methylpentan-2-yl)amino]methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[[methyl(4-methylpentan-2-yl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 79710580 |
| Molecular Formula | C14H23BFNO2 |
| Molecular Weight | 267.15 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [3-fluoro-5-[[methyl(4-methylpentan-2-yl)amino]methyl]phenyl]boronic acid |
| SMILES | CC(C)CC(C)N(C)Cc1cc(F)cc(B(O)O)c1 |
| InChI | InChI=1S/C14H23BFNO2/c1-10(2)5-11(3)17(4)9-12-6-13(15(18)19)8-14(16)7-12/h6-8,10-11,18-19H,5,9H2,1-4H3 |
| InChIKey | AHMZUTQPDIEUTR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|