C13H21BFNO3 — CID 82961102
[3-fluoro-5-[[2-methoxyethyl(propan-2-yl)amino]methyl]phenyl]boronic acid (PubChem CID 82961102) has the molecular formula C13H21BFNO3 and a molecular weight of 269.12 g/mol. Its IUPAC name is [3-fluoro-5-[[2-methoxyethyl(propan-2-yl)amino]methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[[2-methoxyethyl(propan-2-yl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 82961102 |
| Molecular Formula | C13H21BFNO3 |
| Molecular Weight | 269.12 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [3-fluoro-5-[[2-methoxyethyl(propan-2-yl)amino]methyl]phenyl]boronic acid |
| SMILES | COCCN(Cc1cc(F)cc(B(O)O)c1)C(C)C |
| InChI | InChI=1S/C13H21BFNO3/c1-10(2)16(4-5-19-3)9-11-6-12(14(17)18)8-13(15)7-11/h6-8,10,17-18H,4-5,9H2,1-3H3 |
| InChIKey | DUJFCEXWTAHIJO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.12 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|