C13H15BFNO2S — CID 79710128
[3-fluoro-5-[[methyl(thiophen-3-ylmethyl)amino]methyl]phenyl]boronic acid (PubChem CID 79710128) has the molecular formula C13H15BFNO2S and a molecular weight of 279.14 g/mol. Its IUPAC name is [3-fluoro-5-[[methyl(thiophen-3-ylmethyl)amino]methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[[methyl(thiophen-3-ylmethyl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 79710128 |
| Molecular Formula | C13H15BFNO2S |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [3-fluoro-5-[[methyl(thiophen-3-ylmethyl)amino]methyl]phenyl]boronic acid |
| SMILES | CN(Cc1ccsc1)Cc1cc(F)cc(B(O)O)c1 |
| InChI | InChI=1S/C13H15BFNO2S/c1-16(7-10-2-3-19-9-10)8-11-4-12(14(17)18)6-13(15)5-11/h2-6,9,17-18H,7-8H2,1H3 |
| InChIKey | XULFFZZOGSTVIV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|