C15H32N4 — CID 79708398
2-methyl-2-(4-methylpiperazin-1-yl)-N-(piperidin-4-ylmethyl)propan-1-amine (PubChem CID 79708398) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 2-methyl-2-(4-methylpiperazin-1-yl)-N-(piperidin-4-ylmethyl)propan-1-amine.
| Compound Name | 2-methyl-2-(4-methylpiperazin-1-yl)-N-(piperidin-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 79708398 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 2-methyl-2-(4-methylpiperazin-1-yl)-N-(piperidin-4-ylmethyl)propan-1-amine |
| SMILES | CN1CCN(C(C)(C)CNCC2CCNCC2)CC1 |
| InChI | InChI=1S/C15H32N4/c1-15(2,19-10-8-18(3)9-11-19)13-17-12-14-4-6-16-7-5-14/h14,16-17H,4-13H2,1-3H3 |
| InChIKey | IBHFWOPMZAJJPA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |