C15H18BrFN2 — CID 79709515
1-[1-[(3-bromo-5-fluorophenyl)methyl]pyrrol-3-yl]butan-2-amine (PubChem CID 79709515) has the molecular formula C15H18BrFN2 and a molecular weight of 325.23 g/mol. Its IUPAC name is 1-[1-[(3-bromo-5-fluorophenyl)methyl]pyrrol-3-yl]butan-2-amine.
| Compound Name | 1-[1-[(3-bromo-5-fluorophenyl)methyl]pyrrol-3-yl]butan-2-amine |
|---|---|
| PubChem CID | 79709515 |
| Molecular Formula | C15H18BrFN2 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-[1-[(3-bromo-5-fluorophenyl)methyl]pyrrol-3-yl]butan-2-amine |
| SMILES | CCC(N)Cc1ccn(Cc2cc(F)cc(Br)c2)c1 |
| InChI | InChI=1S/C15H18BrFN2/c1-2-15(18)7-11-3-4-19(9-11)10-12-5-13(16)8-14(17)6-12/h3-6,8-9,15H,2,7,10,18H2,1H3 |
| InChIKey | XGAPXUVCWPLOCC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |