C15H17FOS — CID 79709998
3-[3-(cyclopentylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 79709998) has the molecular formula C15H17FOS and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-[3-(cyclopentylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-(cyclopentylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 79709998 |
| Molecular Formula | C15H17FOS |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[3-(cyclopentylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cc(F)cc(CSC2CCCC2)c1 |
| InChI | InChI=1S/C15H17FOS/c16-14-9-12(4-3-7-17)8-13(10-14)11-18-15-5-1-2-6-15/h8-10,15,17H,1-2,5-7,11H2 |
| InChIKey | VSKBJMXTBGJVTR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|