C14H17FN2S — CID 79712298
N-[1-(5-fluoro-2-pyridinyl)-2-thiophen-2-ylethyl]propan-2-amine (PubChem CID 79712298) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-pyridinyl)-2-thiophen-2-ylethyl]propan-2-amine.
| Compound Name | N-[1-(5-fluoro-2-pyridinyl)-2-thiophen-2-ylethyl]propan-2-amine |
|---|---|
| PubChem CID | 79712298 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[1-(5-fluoro-2-pyridinyl)-2-thiophen-2-ylethyl]propan-2-amine |
| SMILES | CC(C)NC(Cc1cccs1)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H17FN2S/c1-10(2)17-14(8-12-4-3-7-18-12)13-6-5-11(15)9-16-13/h3-7,9-10,14,17H,8H2,1-2H3 |
| InChIKey | ASAACFCZVSCKNO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |