C14H17FN2OS — CID 83126443
1-(5-fluoro-2-pyridinyl)-3-[methyl(thiophen-2-ylmethyl)amino]propan-1-ol (PubChem CID 83126443) has the molecular formula C14H17FN2OS and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-[methyl(thiophen-2-ylmethyl)amino]propan-1-ol.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-[methyl(thiophen-2-ylmethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 83126443 |
| Molecular Formula | C14H17FN2OS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-[methyl(thiophen-2-ylmethyl)amino]propan-1-ol |
| SMILES | CN(CCC(O)c1ccc(F)cn1)Cc1cccs1 |
| InChI | InChI=1S/C14H17FN2OS/c1-17(10-12-3-2-8-19-12)7-6-14(18)13-5-4-11(15)9-16-13/h2-5,8-9,14,18H,6-7,10H2,1H3 |
| InChIKey | MMVLWFKLBOJXRG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |