C16H22N2OS — CID 103938524
(1S)-1-[5-[propan-2-yl(thiophen-2-ylmethyl)amino]-2-pyridinyl]propan-1-ol (PubChem CID 103938524) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is (1S)-1-[5-[propan-2-yl(thiophen-2-ylmethyl)amino]-2-pyridinyl]propan-1-ol.
| Compound Name | (1S)-1-[5-[propan-2-yl(thiophen-2-ylmethyl)amino]-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 103938524 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1S)-1-[5-[propan-2-yl(thiophen-2-ylmethyl)amino]-2-pyridinyl]propan-1-ol |
| SMILES | CC[C@H](O)c1ccc(N(Cc2cccs2)C(C)C)cn1 |
| InChI | InChI=1S/C16H22N2OS/c1-4-16(19)15-8-7-13(10-17-15)18(12(2)3)11-14-6-5-9-20-14/h5-10,12,16,19H,4,11H2,1-3H3/t16-/m0/s1 |
| InChIKey | INZAFEVBEGQWOJ-INIZCTEOSA-N |
| XLogP | 4.00 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |