C11H15FN2 — CID 79712819
1-(5-fluoro-2-pyridinyl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 79712819) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 79712819 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CNC(C=C(C)C)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H15FN2/c1-8(2)6-11(13-3)10-5-4-9(12)7-14-10/h4-7,11,13H,1-3H3 |
| InChIKey | BNMANZMLZISVQH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|