C17H15FN2O4 — CID 7971704
[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-methylbenzoate (PubChem CID 7971704) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-methylbenzoate.
| Compound Name | [2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 7971704 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H15FN2O4/c1-11-6-8-12(9-7-11)16(22)24-10-15(21)20-17(23)19-14-5-3-2-4-13(14)18/h2-9H,10H2,1H3,(H2,19,20,21,23) |
| InChIKey | MTZDGEZQMNGZLF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |