C13H24N4O2S — CID 79717482
1-methyl-N-(piperidin-4-ylmethyl)-N-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 79717482) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-methyl-N-(piperidin-4-ylmethyl)-N-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-(piperidin-4-ylmethyl)-N-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 79717482 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-methyl-N-(piperidin-4-ylmethyl)-N-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CC(C)N(CC1CCNCC1)S(=O)(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C13H24N4O2S/c1-11(2)17(9-12-4-6-14-7-5-12)20(18,19)13-8-15-16(3)10-13/h8,10-12,14H,4-7,9H2,1-3H3 |
| InChIKey | LMUGSIVVOQMOHQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |