C14H15FN2 — CID 79722165
(3,5-dimethylphenyl)-(5-fluoro-2-pyridinyl)methanamine (PubChem CID 79722165) has the molecular formula C14H15FN2 and a molecular weight of 230.29 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-(5-fluoro-2-pyridinyl)methanamine.
| Compound Name | (3,5-dimethylphenyl)-(5-fluoro-2-pyridinyl)methanamine |
|---|---|
| PubChem CID | 79722165 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3,5-dimethylphenyl)-(5-fluoro-2-pyridinyl)methanamine |
| SMILES | Cc1cc(C)cc(C(N)c2ccc(F)cn2)c1 |
| InChI | InChI=1S/C14H15FN2/c1-9-5-10(2)7-11(6-9)14(16)13-4-3-12(15)8-17-13/h3-8,14H,16H2,1-2H3 |
| InChIKey | BKKMLJGJKRKPFW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |