C16H17BrFNO4 — CID 7972256
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 7972256) has the molecular formula C16H17BrFNO4 and a molecular weight of 386.22 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7972256 |
| Molecular Formula | C16H17BrFNO4 |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cc(Br)ccc1F)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H17BrFNO4/c17-12-4-5-14(18)11(8-12)3-6-16(21)23-10-15(20)19-9-13-2-1-7-22-13/h3-6,8,13H,1-2,7,9-10H2,(H,19,20)/b6-3+/t13-/m1/s1 |
| InChIKey | XTBGSPYMPCBPOB-VUUYWXRKSA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|