C15H20N4 — CID 79724117
1-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79724117) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79724117 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-N-(3-imidazol-1-ylpropyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2NCCCn1ccnc1 |
| InChI | InChI=1S/C15H20N4/c16-13-3-4-14-12(10-13)2-5-15(14)18-6-1-8-19-9-7-17-11-19/h3-4,7,9-11,15,18H,1-2,5-6,8,16H2 |
| InChIKey | LHBLLFSQFASFFZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|