methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate

C8H10N2O3 — CID 79733482

IUPACmethyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate
SMILESCOC(=O)C1(c2nc(C)no2)CC1
InChIInChI=1S/C8H10N2O3/c1-5-9-6(13-10-5)8(3-4-8)7(11)12-2/h3-4H2,1-2H3
InChIKeyZQEMMSPETWIVJY-UHFFFAOYSA-N
MW182.18 g/mol
LogP0.58
Rot. Bonds2

About methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate

methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate (PubChem CID 79733482) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate
PubChem CID79733482
Molecular FormulaC8H10N2O3
Molecular Weight182.18 g/mol
Exact Mass182.07
IUPAC Namemethyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate
SMILESCOC(=O)C1(c2nc(C)no2)CC1
InChIInChI=1S/C8H10N2O3/c1-5-9-6(13-10-5)8(3-4-8)7(11)12-2/h3-4H2,1-2H3
InChIKeyZQEMMSPETWIVJY-UHFFFAOYSA-N
XLogP0.58
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 50.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate (CID 79733482) is methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate is COC(=O)C1(c2nc(C)no2)CC1.
What is the InChIKey of methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate?
The InChIKey is ZQEMMSPETWIVJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-5-9-6(13-10-5)8(3-4-8)7(11)12-2/h3-4H2,1-2H3.
What are the key properties of methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate?
methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate has a molecular weight of 182.18 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3-methyl-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 79733482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).