C15H23ClFN3 — CID 79733561
N-[[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 79733561) has the molecular formula C15H23ClFN3 and a molecular weight of 299.82 g/mol. Its IUPAC name is N-[[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 79733561 |
| Molecular Formula | C15H23ClFN3 |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1CCCCN1c1ncc(Cl)cc1F |
| InChI | InChI=1S/C15H23ClFN3/c1-15(2,3)19-10-12-6-4-5-7-20(12)14-13(17)8-11(16)9-18-14/h8-9,12,19H,4-7,10H2,1-3H3 |
| InChIKey | GFGZAGPICVUHPG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |