About 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine
2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine (PubChem CID 112676541) has the molecular formula C10H11ClF2N2
and a molecular weight of 232.66 g/mol. Its IUPAC name is 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine.
Molecular Properties
| Compound Name | 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine |
| PubChem CID | 112676541 |
| Molecular Formula | C10H11ClF2N2 |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine |
| SMILES | Fc1cnc(N2CCCC2CCl)c(F)c1 |
| InChI | InChI=1S/C10H11ClF2N2/c11-5-8-2-1-3-15(8)10-9(13)4-7(12)6-14-10/h4,6,8H,1-3,5H2 |
| InChIKey | HFXNHKMPKVPBQB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine?
The IUPAC name of 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine (CID 112676541) is 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine.
What is the SMILES notation for 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine?
The canonical SMILES for 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine is Fc1cnc(N2CCCC2CCl)c(F)c1.
What is the InChIKey of 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine?
The InChIKey is HFXNHKMPKVPBQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClF2N2/c11-5-8-2-1-3-15(8)10-9(13)4-7(12)6-14-10/h4,6,8H,1-3,5H2.
What are the key properties of 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine?
2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine has a molecular weight of 232.66 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(chloromethyl)pyrrolidin-1-yl]-3,5-difluoropyridine is sourced from PubChem (CID 112676541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).