About methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate
methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate (PubChem CID 79733672) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate |
| PubChem CID | 79733672 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2nc(N)n[nH]2)CC1 |
| InChI | InChI=1S/C7H10N4O2/c1-13-5(12)7(2-3-7)4-9-6(8)11-10-4/h2-3H2,1H3,(H3,8,9,10,11) |
| InChIKey | ARBKISRBKRUCAK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate (CID 79733672) is methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate is COC(=O)C1(c2nc(N)n[nH]2)CC1.
What is the InChIKey of methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate?
The InChIKey is ARBKISRBKRUCAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c1-13-5(12)7(2-3-7)4-9-6(8)11-10-4/h2-3H2,1H3,(H3,8,9,10,11).
What are the key properties of methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate?
methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate has a molecular weight of 182.18 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3-amino-1H-1,2,4-triazol-5-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 79733672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).