C10H18N4O2 — CID 79471915
ethyl 2-(3-amino-1H-1,2,4-triazol-5-yl)-2-ethylbutanoate (PubChem CID 79471915) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 2-(3-amino-1H-1,2,4-triazol-5-yl)-2-ethylbutanoate.
| Compound Name | ethyl 2-(3-amino-1H-1,2,4-triazol-5-yl)-2-ethylbutanoate |
|---|---|
| PubChem CID | 79471915 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | ethyl 2-(3-amino-1H-1,2,4-triazol-5-yl)-2-ethylbutanoate |
| SMILES | CCOC(=O)C(CC)(CC)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C10H18N4O2/c1-4-10(5-2,8(15)16-6-3)7-12-9(11)14-13-7/h4-6H2,1-3H3,(H3,11,12,13,14) |
| InChIKey | QZMIGOYKIFECGF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |