C12H21N3O2 — CID 79471825
ethyl 2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butanoate (PubChem CID 79471825) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is ethyl 2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butanoate.
| Compound Name | ethyl 2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butanoate |
|---|---|
| PubChem CID | 79471825 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | ethyl 2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butanoate |
| SMILES | CCOC(=O)C(CC)(CC)c1n[nH]c(CC)n1 |
| InChI | InChI=1S/C12H21N3O2/c1-5-9-13-10(15-14-9)12(6-2,7-3)11(16)17-8-4/h5-8H2,1-4H3,(H,13,14,15) |
| InChIKey | GRDTZELFKBFMLF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |