C10H20N4 — CID 115431364
2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butan-1-amine (PubChem CID 115431364) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butan-1-amine.
| Compound Name | 2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 115431364 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 2-ethyl-2-(5-ethyl-1H-1,2,4-triazol-3-yl)butan-1-amine |
| SMILES | CCc1nc(C(CC)(CC)CN)n[nH]1 |
| InChI | InChI=1S/C10H20N4/c1-4-8-12-9(14-13-8)10(5-2,6-3)7-11/h4-7,11H2,1-3H3,(H,12,13,14) |
| InChIKey | BMASFBIVEZQHJQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |