C11H18N2O2S — CID 138673569
ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethylbutanoate (PubChem CID 138673569) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethylbutanoate.
| Compound Name | ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethylbutanoate |
|---|---|
| PubChem CID | 138673569 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-ethylbutanoate |
| SMILES | CCOC(=O)C(CC)(CC)c1csc(N)n1 |
| InChI | InChI=1S/C11H18N2O2S/c1-4-11(5-2,9(14)15-6-3)8-7-16-10(12)13-8/h7H,4-6H2,1-3H3,(H2,12,13) |
| InChIKey | MVILWFDAOOWUGL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |