C8H12N2O4S — CID 174539726
[(2-amino-1,3-thiazol-4-yl)-dimethoxymethyl] acetate (PubChem CID 174539726) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is [(2-amino-1,3-thiazol-4-yl)-dimethoxymethyl] acetate.
| Compound Name | [(2-amino-1,3-thiazol-4-yl)-dimethoxymethyl] acetate |
|---|---|
| PubChem CID | 174539726 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | [(2-amino-1,3-thiazol-4-yl)-dimethoxymethyl] acetate |
| SMILES | COC(OC)(OC(C)=O)c1csc(N)n1 |
| InChI | InChI=1S/C8H12N2O4S/c1-5(11)14-8(12-2,13-3)6-4-15-7(9)10-6/h4H,1-3H3,(H2,9,10) |
| InChIKey | JAQPSZOTIAZLMP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|