C15H13BrN4O — CID 79735745
6-amino-N-(5-bromo-4-methyl-2-pyridinyl)-1H-indole-3-carboxamide (PubChem CID 79735745) has the molecular formula C15H13BrN4O and a molecular weight of 345.20 g/mol. Its IUPAC name is 6-amino-N-(5-bromo-4-methyl-2-pyridinyl)-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N-(5-bromo-4-methyl-2-pyridinyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 79735745 |
| Molecular Formula | C15H13BrN4O |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 6-amino-N-(5-bromo-4-methyl-2-pyridinyl)-1H-indole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c[nH]c3cc(N)ccc23)ncc1Br |
| InChI | InChI=1S/C15H13BrN4O/c1-8-4-14(19-7-12(8)16)20-15(21)11-6-18-13-5-9(17)2-3-10(11)13/h2-7,18H,17H2,1H3,(H,19,20,21) |
| InChIKey | JQTKGLCMWVTXPU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|