C9H12N4S — CID 79737828
5-[(1-ethylimidazol-2-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 79737828) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is 5-[(1-ethylimidazol-2-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(1-ethylimidazol-2-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79737828 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-[(1-ethylimidazol-2-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCn1ccnc1Cc1cnc(N)s1 |
| InChI | InChI=1S/C9H12N4S/c1-2-13-4-3-11-8(13)5-7-6-12-9(10)14-7/h3-4,6H,2,5H2,1H3,(H2,10,12) |
| InChIKey | CQUFMZNQAORLCM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |