C17H17NOS — CID 79739397
1-(1-benzothiophen-3-yl)-2-(5-ethyl-2-pyridinyl)ethanol (PubChem CID 79739397) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-2-(5-ethyl-2-pyridinyl)ethanol.
| Compound Name | 1-(1-benzothiophen-3-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 79739397 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2csc3ccccc23)nc1 |
| InChI | InChI=1S/C17H17NOS/c1-2-12-7-8-13(18-10-12)9-16(19)15-11-20-17-6-4-3-5-14(15)17/h3-8,10-11,16,19H,2,9H2,1H3 |
| InChIKey | YNZXOGUFVHLWJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |