C12H20N2O — CID 79741678
N-[1-(2,5-dimethylfuran-3-yl)ethyl]pyrrolidin-3-amine (PubChem CID 79741678) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is N-[1-(2,5-dimethylfuran-3-yl)ethyl]pyrrolidin-3-amine.
| Compound Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 79741678 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]pyrrolidin-3-amine |
| SMILES | Cc1cc(C(C)NC2CCNC2)c(C)o1 |
| InChI | InChI=1S/C12H20N2O/c1-8-6-12(10(3)15-8)9(2)14-11-4-5-13-7-11/h6,9,11,13-14H,4-5,7H2,1-3H3 |
| InChIKey | BHTFDXAOLDLIOZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |