About 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine
1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine (PubChem CID 79459068) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine |
| PubChem CID | 79459068 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine |
| SMILES | Cc1cc(C(C)NC2CCCC(N)C2)c(C)o1 |
| InChI | InChI=1S/C14H24N2O/c1-9-7-14(11(3)17-9)10(2)16-13-6-4-5-12(15)8-13/h7,10,12-13,16H,4-6,8,15H2,1-3H3 |
| InChIKey | ULJTVKFNBIJXNC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine?
The IUPAC name of 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine (CID 79459068) is 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine.
What is the SMILES notation for 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine?
The canonical SMILES for 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine is Cc1cc(C(C)NC2CCCC(N)C2)c(C)o1.
What is the InChIKey of 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine?
The InChIKey is ULJTVKFNBIJXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-9-7-14(11(3)17-9)10(2)16-13-6-4-5-12(15)8-13/h7,10,12-13,16H,4-6,8,15H2,1-3H3.
What are the key properties of 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine?
1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine has a molecular weight of 236.36 g/mol, XLogP of 2.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[1-(2,5-dimethylfuran-3-yl)ethyl]cyclohexane-1,3-diamine is sourced from PubChem (CID 79459068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).