C15H24N2 — CID 79742171
1-N-propan-2-yl-1-N-propyl-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79742171) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-N-propan-2-yl-1-N-propyl-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-propan-2-yl-1-N-propyl-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79742171 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-N-propan-2-yl-1-N-propyl-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CCCN(C(C)C)C1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H24N2/c1-4-9-17(11(2)3)15-8-5-12-10-13(16)6-7-14(12)15/h6-7,10-11,15H,4-5,8-9,16H2,1-3H3 |
| InChIKey | PPVQWMOIRKFYKJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|