C20H22BrNO — CID 7974371
(E)-3-(3-bromophenyl)-N-[2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide (PubChem CID 7974371) has the molecular formula C20H22BrNO and a molecular weight of 372.31 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-[2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 7974371 |
| Molecular Formula | C20H22BrNO |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide |
| SMILES | CC(C)c1ccc(CCNC(=O)/C=C/c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C20H22BrNO/c1-15(2)18-9-6-16(7-10-18)12-13-22-20(23)11-8-17-4-3-5-19(21)14-17/h3-11,14-15H,12-13H2,1-2H3,(H,22,23)/b11-8+ |
| InChIKey | FSNSHWNVOAQYKA-DHZHZOJOSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|