C16H28N2 — CID 79747783
1-(5-ethyl-2-pyridinyl)-N-propylhexan-2-amine (PubChem CID 79747783) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(5-ethyl-2-pyridinyl)-N-propylhexan-2-amine.
| Compound Name | 1-(5-ethyl-2-pyridinyl)-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 79747783 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-(5-ethyl-2-pyridinyl)-N-propylhexan-2-amine |
| SMILES | CCCCC(Cc1ccc(CC)cn1)NCCC |
| InChI | InChI=1S/C16H28N2/c1-4-7-8-15(17-11-5-2)12-16-10-9-14(6-3)13-18-16/h9-10,13,15,17H,4-8,11-12H2,1-3H3 |
| InChIKey | IROGCFGYMOKSCX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |