C15H23F3N2 — CID 79954795
1-(5-ethyl-2-pyridinyl)-5,5,5-trifluoro-N-propylpentan-2-amine (PubChem CID 79954795) has the molecular formula C15H23F3N2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-(5-ethyl-2-pyridinyl)-5,5,5-trifluoro-N-propylpentan-2-amine.
| Compound Name | 1-(5-ethyl-2-pyridinyl)-5,5,5-trifluoro-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 79954795 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-(5-ethyl-2-pyridinyl)-5,5,5-trifluoro-N-propylpentan-2-amine |
| SMILES | CCCNC(CCC(F)(F)F)Cc1ccc(CC)cn1 |
| InChI | InChI=1S/C15H23F3N2/c1-3-9-19-14(7-8-15(16,17)18)10-13-6-5-12(4-2)11-20-13/h5-6,11,14,19H,3-4,7-10H2,1-2H3 |
| InChIKey | LUKHJILANCLHQU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |