C17H25N3 — CID 79750073
4-methyl-5-(1-methylbenzimidazol-2-yl)-N-propylpent-3-en-1-amine (PubChem CID 79750073) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 4-methyl-5-(1-methylbenzimidazol-2-yl)-N-propylpent-3-en-1-amine.
| Compound Name | 4-methyl-5-(1-methylbenzimidazol-2-yl)-N-propylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79750073 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 4-methyl-5-(1-methylbenzimidazol-2-yl)-N-propylpent-3-en-1-amine |
| SMILES | CCCNCCC=C(C)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C17H25N3/c1-4-11-18-12-7-8-14(2)13-17-19-15-9-5-6-10-16(15)20(17)3/h5-6,8-10,18H,4,7,11-13H2,1-3H3 |
| InChIKey | QRHAMMFVWCGIHN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|