About 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol
6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol (PubChem CID 79755983) has the molecular formula C12H11F3O
and a molecular weight of 228.21 g/mol. Its IUPAC name is 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol.
Molecular Properties
| Compound Name | 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol |
| PubChem CID | 79755983 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol |
| SMILES | OC1(c2ccc(F)c(F)c2F)C2CCCC21 |
| InChI | InChI=1S/C12H11F3O/c13-9-5-4-8(10(14)11(9)15)12(16)6-2-1-3-7(6)12/h4-7,16H,1-3H2 |
| InChIKey | FDGYOCZKCNWSOM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol?
The IUPAC name of 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol (CID 79755983) is 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol.
What is the SMILES notation for 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol?
The canonical SMILES for 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol is OC1(c2ccc(F)c(F)c2F)C2CCCC21.
What is the InChIKey of 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol?
The InChIKey is FDGYOCZKCNWSOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3O/c13-9-5-4-8(10(14)11(9)15)12(16)6-2-1-3-7(6)12/h4-7,16H,1-3H2.
What are the key properties of 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol?
6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol has a molecular weight of 228.21 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3,4-trifluorophenyl)bicyclo[3.1.0]hexan-6-ol is sourced from PubChem (CID 79755983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).