C11H5BrClF3S — CID 79757506
2-bromo-5-[chloro-(2,3,4-trifluorophenyl)methyl]thiophene (PubChem CID 79757506) has the molecular formula C11H5BrClF3S and a molecular weight of 341.58 g/mol. Its IUPAC name is 2-bromo-5-[chloro-(2,3,4-trifluorophenyl)methyl]thiophene.
| Compound Name | 2-bromo-5-[chloro-(2,3,4-trifluorophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 79757506 |
| Molecular Formula | C11H5BrClF3S |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | 2-bromo-5-[chloro-(2,3,4-trifluorophenyl)methyl]thiophene |
| SMILES | Fc1ccc(C(Cl)c2ccc(Br)s2)c(F)c1F |
| InChI | InChI=1S/C11H5BrClF3S/c12-8-4-3-7(17-8)9(13)5-1-2-6(14)11(16)10(5)15/h1-4,9H |
| InChIKey | YSKXLGNHUDAEKT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|