C14H27N3O2 — CID 79760658
1,1-dimethoxy-N-propyl-3-(1-propylimidazol-2-yl)propan-2-amine (PubChem CID 79760658) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1,1-dimethoxy-N-propyl-3-(1-propylimidazol-2-yl)propan-2-amine.
| Compound Name | 1,1-dimethoxy-N-propyl-3-(1-propylimidazol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 79760658 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1,1-dimethoxy-N-propyl-3-(1-propylimidazol-2-yl)propan-2-amine |
| SMILES | CCCNC(Cc1nccn1CCC)C(OC)OC |
| InChI | InChI=1S/C14H27N3O2/c1-5-7-15-12(14(18-3)19-4)11-13-16-8-10-17(13)9-6-2/h8,10,12,14-15H,5-7,9,11H2,1-4H3 |
| InChIKey | JPEBKASJWQOMJP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|