C14H19BrO — CID 79762725
3-[bromo-(3,4-dimethylphenyl)methyl]-2-methyloxolane (PubChem CID 79762725) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is 3-[bromo-(3,4-dimethylphenyl)methyl]-2-methyloxolane.
| Compound Name | 3-[bromo-(3,4-dimethylphenyl)methyl]-2-methyloxolane |
|---|---|
| PubChem CID | 79762725 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-[bromo-(3,4-dimethylphenyl)methyl]-2-methyloxolane |
| SMILES | Cc1ccc(C(Br)C2CCOC2C)cc1C |
| InChI | InChI=1S/C14H19BrO/c1-9-4-5-12(8-10(9)2)14(15)13-6-7-16-11(13)3/h4-5,8,11,13-14H,6-7H2,1-3H3 |
| InChIKey | LLYKVRDBYLUXLD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|